Difference between revisions of "PWY0-501"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA ACETYL-COA] == * common-name: ** acetyl-coa * smiles: ** cc(=o)sccnc(=o)ccnc(=o)c(o)...")
 
(Created page with "Category:pathway == Pathway PWY0-501 == * taxonomic-range: ** tax-33090 ** tax-2 ** tax-2759 * common-name: ** lipoate biosynthesis and incorporation i == Reaction(s) foun...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA ACETYL-COA] ==
+
== Pathway PWY0-501 ==
 +
* taxonomic-range:
 +
** tax-33090
 +
** tax-2
 +
** tax-2759
 
* common-name:
 
* common-name:
** acetyl-coa
+
** lipoate biosynthesis and incorporation i
* smiles:
+
== Reaction(s) found ==
** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[RXN0-947]]
* inchi-key:
+
* [[RXN0-949]]
** zslzbfcdcinbpy-zsjpkinusa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 805.54
+
{{#set: taxonomic-range=tax-2|tax-2759|tax-33090}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=lipoate biosynthesis and incorporation i}}
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: nb reaction found=2}}
* [[1.2.1.18-RXN]]
+
{{#set: completion rate=1.0}}
* [[2-ISOPROPYLMALATESYN-RXN]]
+
{{#set: nb total reaction=2}}
* [[2.3.1.157-RXN]]
 
* [[2.3.1.180-RXN]]
 
* [[2.3.1.45-RXN]]
 
* [[2.3.1.67-RXN]]
 
* [[ACACT]]
 
* [[ACACT1h]]
 
* [[ACACT2h]]
 
* [[ACACT4]]
 
* [[ACACT4h]]
 
* [[ACACT6]]
 
* [[ACACT6h]]
 
* [[ACACT7]]
 
* [[ACACT7h]]
 
* [[ACACT7m]]
 
* [[ACCOAth]]
 
* [[ACCOAtm]]
 
* [[ACCOAtx]]
 
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[CITSYN-RXN]]
 
* [[CSm]]
 
* [[DIHYDLIPACETRANS-RXN]]
 
* [[FATTY-ACID-SYNTHASE-RXN]]
 
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
* [[IPMS]]
 
* [[MALSYN-RXN]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
* [[PHOSACETYLTRANS-RXN]]
 
* [[PYFLAVOXRE-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[RXN-12565]]
 
* [[RXN-13431]]
 
* [[RXN-14274]]
 
* [[RXN-14277]]
 
* [[RXN-16016]]
 
* [[RXN-16017]]
 
* [[RXN-7864]]
 
* [[RXN-8032]]
 
* [[RXN0-5055]]
 
* [[RXN0-6948]]
 
* [[SERINE-O-ACETTRAN-RXN]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.2.1.18-RXN]]
 
* [[2.3.1.45-RXN]]
 
* [[2.3.1.67-RXN]]
 
* [[ACACT1h]]
 
* [[ACACT4]]
 
* [[ACACT6]]
 
* [[ACACT7]]
 
* [[ACCAT]]
 
* [[ACCOAth]]
 
* [[ACCOAtm]]
 
* [[ACCOAtx]]
 
* [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
 
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
 
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
 
* [[ACETATE--COA-LIGASE-RXN]]
 
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 
* [[ACOACXr]]
 
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
* [[AKBLIG-RXN]]
 
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPCL]]
 
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
* [[KETOACYLCOATHIOL-RXN]]
 
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
* [[PHOSACETYLTRANS-RXN]]
 
* [[PYFLAVOXRE-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[PYRUVDEH-RXN]]
 
* [[RXN-10699]]
 
* [[RXN-10700]]
 
* [[RXN-10701]]
 
* [[RXN-11246]]
 
* [[RXN-11917]]
 
* [[RXN-11921]]
 
* [[RXN-12561]]
 
* [[RXN-12710]]
 
* [[RXN-13617]]
 
* [[RXN-14268]]
 
* [[RXN-14274]]
 
* [[RXN-14277]]
 
* [[RXN-14394]]
 
* [[RXN-14774]]
 
* [[RXN-14788]]
 
* [[RXN-14793]]
 
* [[RXN-14799]]
 
* [[RXN-14803]]
 
* [[RXN-16137]]
 
* [[RXN-17116]]
 
* [[RXN-17778]]
 
* [[RXN-17782]]
 
* [[RXN-17787]]
 
* [[RXN-17791]]
 
* [[RXN-17795]]
 
* [[RXN-17799]]
 
* [[RXN-2006]]
 
* [[RXN-2902]]
 
* [[RXN-7864]]
 
* [[RXN-8032]]
 
* [[RXN-9958]]
 
* [[RXN0-1133]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=acetyl-coa}}
 
{{#set: inchi-key=inchikey=zslzbfcdcinbpy-zsjpkinusa-j}}
 
{{#set: molecular-weight=805.54}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY0-501

  • taxonomic-range:
    • tax-33090
    • tax-2
    • tax-2759
  • common-name:
    • lipoate biosynthesis and incorporation i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present