Difference between revisions of "PWY0-661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1...")
 
(Created page with "Category:pathway == Pathway PWY0-661 == * taxonomic-range: ** tax-2 * common-name: ** prpp biosynthesis ii == Reaction(s) found == * PPENTOMUT-RXN == Reaction(s) not f...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] ==
+
== Pathway PWY0-661 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 2-cis,4-trans-xanthoxin
+
** prpp biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
+
* [[PPENTOMUT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ztalkmxohwqnia-tvbshjcbsa-n
+
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 250.337
+
{{#set: common-name=prpp biosynthesis ii}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[1.1.1.288-RXN]]
+
{{#set: completion rate=n.a}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=n.a}}
* [[RXN-698]]
 
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=2-cis,4-trans-xanthoxin}}
 
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
 
{{#set: molecular-weight=250.337}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY0-661

  • taxonomic-range:
    • tax-2
  • common-name:
    • prpp biosynthesis ii

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available