Difference between revisions of "PWY0-661"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * common-name: ** 2-cis,4-trans-xanthoxin * smiles: ** cc(c=cc12(c(cc(cc1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METOH METOH] == * common-name: ** methanol * smiles: ** co * inchi-key: ** okkjlvbelutlkv-uhfff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METOH METOH] ==
 
* common-name:
 
* common-name:
** 2-cis,4-trans-xanthoxin
+
** methanol
 
* smiles:
 
* smiles:
** cc(c=cc12(c(cc(cc1(c)o2)o)(c)c))=cc=o
+
** co
 
* inchi-key:
 
* inchi-key:
** ztalkmxohwqnia-tvbshjcbsa-n
+
** okkjlvbelutlkv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 250.337
+
** 32.042
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.288-RXN]]
+
* [[METHANOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-14189]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-698]]
+
* [[METHANOL-DEHYDROGENASE-RXN]]
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
+
* [[RXN-10711]]
 +
* [[RXN-10767]]
 +
* [[RXN-12322]]
 +
* [[RXN-15776]]
 +
* [[RXN-8409]]
 +
* [[RXNQT-4366]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,4-trans-xanthoxin}}
+
{{#set: common-name=methanol}}
{{#set: inchi-key=inchikey=ztalkmxohwqnia-tvbshjcbsa-n}}
+
{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}
{{#set: molecular-weight=250.337}}
+
{{#set: molecular-weight=32.042}}

Revision as of 14:19, 26 August 2019

Metabolite METOH

  • common-name:
    • methanol
  • smiles:
    • co
  • inchi-key:
    • okkjlvbelutlkv-uhfffaoysa-n
  • molecular-weight:
    • 32.042

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality