Difference between revisions of "PWY0-662"
Jump to navigation
Jump to search
(Semantic MediaWiki default vocabulary import) |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=...") |
||
| Line 1: | Line 1: | ||
| − | * [[ | + | [[Category:metabolite]] |
| − | * [[ | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == |
| − | + | * common-name: | |
| − | [[ | + | ** 4'-phosphopantetheine |
| + | * smiles: | ||
| + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** jdmuprlruumctl-vifpvbqesa-l | ||
| + | * molecular-weight: | ||
| + | ** 356.33 | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTEPADENYLYLTRAN-RXN]] | ||
| + | * [[PANTETHEINE-KINASE-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.4.14-RXN]] | ||
| + | * [[P-PANTOCYSDECARB-RXN]] | ||
| + | * [[PANTETHEINE-KINASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=4'-phosphopantetheine}} | ||
| + | {{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}} | ||
| + | {{#set: molecular-weight=356.33}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite PANTETHEINE-P
- common-name:
- 4'-phosphopantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
- inchi-key:
- jdmuprlruumctl-vifpvbqesa-l
- molecular-weight:
- 356.33
