Difference between revisions of "PWY0-662"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=...")
(Created page with "Category:pathway == Pathway PWY0-662 == * taxonomic-range: ** tax-2759 ** tax-2157 ** tax-2 * common-name: ** prpp biosynthesis i == Reaction(s) found == * PRPPSYN-RXN...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] ==
+
== Pathway PWY0-662 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2157
 +
** tax-2
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** prpp biosynthesis i
* smiles:
+
== Reaction(s) found ==
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
+
* [[PRPPSYN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** jdmuprlruumctl-vifpvbqesa-l
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
** 356.33
+
{{#set: common-name=prpp biosynthesis i}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[PANTEPADENYLYLTRAN-RXN]]
+
{{#set: completion rate=1.0}}
* [[PANTETHEINE-KINASE-RXN]]
+
{{#set: nb total reaction=1}}
== Reaction(s) known to produce the compound ==
 
* [[3.1.4.14-RXN]]
 
* [[P-PANTOCYSDECARB-RXN]]
 
* [[PANTETHEINE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4'-phosphopantetheine}}
 
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
 
{{#set: molecular-weight=356.33}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY0-662

  • taxonomic-range:
    • tax-2759
    • tax-2157
    • tax-2
  • common-name:
    • prpp biosynthesis i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present