Difference between revisions of "PWY0-901"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-277 CPD-277] == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])...")
(Created page with "Category:pathway == Pathway PWY0-901 == * taxonomic-range: ** tax-2 * common-name: ** l-selenocysteine biosynthesis i (bacteria) == Reaction(s) found == * 2.7.9.3-RXN...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-277 CPD-277] ==
+
== Pathway PWY0-901 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3-fumarylpyruvate
+
** l-selenocysteine biosynthesis i (bacteria)
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
+
* [[2.7.9.3-RXN]]
* inchi-key:
+
* [[RXN0-2161]]
** azcflhzufanaor-owojbtedsa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None2.9.1.1-RXN 2.9.1.1-RXN]
** 184.105
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-selenocysteine biosynthesis i (bacteria)}}
* [[RXN-10445]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=3-fumarylpyruvate}}
 
{{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}}
 
{{#set: molecular-weight=184.105}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY0-901

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-selenocysteine biosynthesis i (bacteria)

Reaction(s) found

Reaction(s) not found

  • [None2.9.1.1-RXN 2.9.1.1-RXN]