Difference between revisions of "PWY1G-0"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1803 CPD-1803] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] ==
 * common-name:
-** n-acetyl-7-o-acetylneuraminate
+** dudp
 * smiles:
-** cc(=o)nc1(c(cc(c(=o)[o-])(o)o[ch]1c(oc(c)=o)c(o)co)o)
+** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 * inchi-key:
-** duokwmwkfgdudq-grrzbweesa-m
+** qhwztvccbmiike-shyzeuofsa-k
 * molecular-weight:
-** 350.302
+** 385.14
 == Reaction(s) known to consume the compound ==
-* [[2.3.1.45-RXN]]
+* [[ATDUD]]
+* [[ATDUDm]]
+* [[DUDPKIN-RXN]]
+* [[RXN-14220]]
 == Reaction(s) known to produce the compound ==
-* [[2.3.1.45-RXN]]
+* [[DUDT]]
+* [[DUTCP]]
+* [[DUTUP]]
+* [[RXN-14219]]
+* [[RXN0-722]]
+* [[UDPREDUCT-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n-acetyl-7-o-acetylneuraminate}}
+{{#set: common-name=dudp}}
-{{#set: inchi-key=inchikey=duokwmwkfgdudq-grrzbweesa-m}}
+{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
-{{#set: molecular-weight=350.302}}
+{{#set: molecular-weight=385.14}}