Difference between revisions of "PWY3DJ-11281"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETHYLENE-CMPD ETHYLENE-CMPD] == * common-name: ** ethene * smiles: ** c=c * inchi-key: ** vggsq...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14795 CPD-14795] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETHYLENE-CMPD ETHYLENE-CMPD] ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-galactosamine
+
** ethene
 
* smiles:
 
* smiles:
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
+
** c=c
 
* inchi-key:
 
* inchi-key:
** lftytuazoprmmi-nessujcysa-l
+
** vggsqfucumxweo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 605.342
+
** 28.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13760]]
 
* [[RXN-14841]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13760]]
+
* [[ETHYL-RXN]]
* [[RXN-14841]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-galactosamine}}
+
{{#set: common-name=ethene}}
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
+
{{#set: inchi-key=inchikey=vggsqfucumxweo-uhfffaoysa-n}}
{{#set: molecular-weight=605.342}}
+
{{#set: molecular-weight=28.054}}

Revision as of 14:18, 26 August 2019

Metabolite ETHYLENE-CMPD

  • common-name:
    • ethene
  • smiles:
    • c=c
  • inchi-key:
    • vggsqfucumxweo-uhfffaoysa-n
  • molecular-weight:
    • 28.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality