Difference between revisions of "PWY3O-19"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2184 CPD0-2184] ==
+== Pathway PWY3O-19 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** (2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate
+** ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic)
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c=cc(=o)c=cc=c(c([o-])=o)o
+* [[2.1.1.114-RXN]]
-* inchi-key:
+* [[RXN-9003]]
-** wcjyzufkktynlb-aritwgjrsa-l
+* [[RXN3O-102]]
-* molecular-weight:
+* [[RXN3O-54]]
-** 210.143
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN3O-58 RXN3O-58]
-* [[RXN-12070]]
+* [NoneRXN3O-75 RXN3O-75]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN3O-73 RXN3O-73]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-20172 RXN-20172]
-{{#set: common-name=(2z,4e,7e)-2-hydroxy-6-oxonona-2,4,7-triene-1,9-dioate}}
+* [NoneRXN3O-12 RXN3O-12]
-{{#set: inchi-key=inchikey=wcjyzufkktynlb-aritwgjrsa-l}}
+{{#set: taxonomic-range=tax-4751}}
-{{#set: molecular-weight=210.143}}
+{{#set: common-name=ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic)}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.5}}
+{{#set: nb total reaction=8}}