Difference between revisions of "PWY3O-19"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1...")
(Created page with "Category:pathway == Pathway PWY3O-19 == * taxonomic-range: ** tax-4751 * common-name: ** ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic) == Reaction(s) found...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] ==
+
== Pathway PWY3O-19 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** methyl (indol-3-yl)acetate
+
** ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic)
* smiles:
+
== Reaction(s) found ==
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
+
* [[2.1.1.114-RXN]]
* inchi-key:
+
* [[RXN-9003]]
** kthadmdgdnyqrx-uhfffaoysa-n
+
* [[RXN3O-102]]
* molecular-weight:
+
* [[RXN3O-54]]
** 189.213
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN3O-58 RXN3O-58]
* [[RXN-10711]]
+
* [NoneRXN3O-75 RXN3O-75]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN3O-73 RXN3O-73]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-20172 RXN-20172]
{{#set: common-name=methyl (indol-3-yl)acetate}}
+
* [NoneRXN3O-12 RXN3O-12]
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
+
{{#set: taxonomic-range=tax-4751}}
{{#set: molecular-weight=189.213}}
+
{{#set: common-name=ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic)}}
 +
{{#set: nb reaction found=4}}
 +
{{#set: completion rate=0.5}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY3O-19

  • taxonomic-range:
    • tax-4751
  • common-name:
    • ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN3O-58 RXN3O-58]
  • [NoneRXN3O-75 RXN3O-75]
  • [NoneRXN3O-73 RXN3O-73]
  • [NoneRXN-20172 RXN-20172]
  • [NoneRXN3O-12 RXN3O-12]