Difference between revisions of "PWY3O-19"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-fucose-protein-serine L-fucose-protein-serine] == * common-name: ** a [protein]-3-o-l-fucosyl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == |
* common-name: | * common-name: | ||
| − | ** | + | ** methyl (indol-3-yl)acetate |
| + | * smiles: | ||
| + | ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) | ||
| + | * inchi-key: | ||
| + | ** kthadmdgdnyqrx-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 189.213 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10711]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methyl (indol-3-yl)acetate}} |
| + | {{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=189.213}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-10546
- common-name:
- methyl (indol-3-yl)acetate
- smiles:
- coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
- inchi-key:
- kthadmdgdnyqrx-uhfffaoysa-n
- molecular-weight:
- 189.213
