Difference between revisions of "PWY3O-19"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1...")
(Created page with "Category:pathway == Pathway PWY-7436 == * taxonomic-range: ** tax-3398 * common-name: ** vitamin e biosynthesis (tocotrienols) == Reaction(s) found == * RXN-14917 * ...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] ==
+
== Pathway PWY-7436 ==
 +
* taxonomic-range:
 +
** tax-3398
 
* common-name:
 
* common-name:
** methyl (indol-3-yl)acetate
+
** vitamin e biosynthesis (tocotrienols)
* smiles:
+
== Reaction(s) found ==
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
+
* [[RXN-14917]]
* inchi-key:
+
* [[RXN-14918]]
** kthadmdgdnyqrx-uhfffaoysa-n
+
* [[RXN-14919]]
* molecular-weight:
+
* [[RXN-14929]]
** 189.213
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-14922 RXN-14922]
* [[RXN-10711]]
+
* [NoneRXN-14921 RXN-14921]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-3398}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=vitamin e biosynthesis (tocotrienols)}}
{{#set: common-name=methyl (indol-3-yl)acetate}}
+
{{#set: nb reaction found=4}}
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
+
{{#set: completion rate=0.67}}
{{#set: molecular-weight=189.213}}
+
{{#set: nb total reaction=6}}

Revision as of 20:18, 18 December 2020

Pathway PWY-7436

  • taxonomic-range:
    • tax-3398
  • common-name:
    • vitamin e biosynthesis (tocotrienols)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14922 RXN-14922]
  • [NoneRXN-14921 RXN-14921]