Difference between revisions of "PWY3O-246"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * common-name: ** udp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n...")
(Created page with "Category:pathway == Pathway PWY-6030 == * taxonomic-range: ** tax-33090 ** tax-33208 * common-name: ** serotonin and melatonin biosynthesis == Reaction(s) found == * RXN...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] ==
+
== Pathway PWY-6030 ==
 +
* taxonomic-range:
 +
** tax-33090
 +
** tax-33208
 
* common-name:
 
* common-name:
−
** udp
+
** serotonin and melatonin biosynthesis
−
* smiles:
+
== Reaction(s) found ==
−
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
* [[RXN3DJ-170]]
−
* inchi-key:
+
== Reaction(s) not found ==
−
** xcctyiawtasojw-xvfcmesisa-k
+
* [NoneACETYLSEROTONIN-O-METHYLTRANSFERASE-RXN ACETYLSEROTONIN-O-METHYLTRANSFERASE-RXN]
−
* molecular-weight:
+
* [NoneRXN3DJ-35528 RXN3DJ-35528]
−
** 401.14
+
* [NoneTRYPTOPHAN-5-MONOOXYGENASE-RXN TRYPTOPHAN-5-MONOOXYGENASE-RXN]
−
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090|tax-33208}}
−
* [[2.4.1.198-RXN]]
+
{{#set: common-name=serotonin and melatonin biosynthesis}}
−
* [[2.4.1.229-RXN]]
+
{{#set: nb reaction found=1}}
−
* [[2.4.1.94-RXN]]
+
{{#set: completion rate=0.25}}
−
* [[ATUD]]
+
{{#set: nb total reaction=4}}
−
* [[ATUDm]]
 
−
* [[DUDT]]
 
−
* [[R00157]]
 
−
* [[RXN-11627]]
 
−
* [[RXN-11889]]
 
−
* [[RXN-11890]]
 
−
* [[RXN-12197]]
 
−
* [[RXN-14841]]
 
−
* [[RXN-16027]]
 
−
* [[RXN-7873]]
 
−
* [[RXN0-722]]
 
−
* [[UDPGth]]
 
−
* [[UDPKIN-RXN]]
 
−
* [[UDPREDUCT-RXN]]
 
−
* [[UMPU]]
 
−
== Reaction(s) known to produce the compound ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
−
* [[2.4.1.101-RXN]]
 
−
* [[2.4.1.117-RXN]]
 
−
* [[2.4.1.122-RXN]]
 
−
* [[2.4.1.123-RXN]]
 
−
* [[2.4.1.134-RXN]]
 
−
* [[2.4.1.141-RXN]]
 
−
* [[2.4.1.145-RXN]]
 
−
* [[2.4.1.151-RXN]]
 
−
* [[2.4.1.155-RXN]]
 
−
* [[2.4.1.198-RXN]]
 
−
* [[2.4.1.201-RXN]]
 
−
* [[2.4.1.212-RXN]]
 
−
* [[2.4.1.223-RXN]]
 
−
* [[2.4.1.224-RXN]]
 
−
* [[2.4.1.225-RXN]]
 
−
* [[2.4.1.229-RXN]]
 
−
* [[2.4.1.38-RXN]]
 
−
* [[2.4.1.46-RXN]]
 
−
* [[2.4.1.94-RXN]]
 
−
* [[2.4.2.26-RXN]]
 
−
* [[2.4.2.38-RXN]]
 
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
−
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[LACTOSE-SYNTHASE-RXN]]
 
−
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
 
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[R00157]]
 
−
* [[RXN-10606]]
 
−
* [[RXN-10607]]
 
−
* [[RXN-10608]]
 
−
* [[RXN-10609]]
 
−
* [[RXN-10616]]
 
−
* [[RXN-10617]]
 
−
* [[RXN-10618]]
 
−
* [[RXN-10619]]
 
−
* [[RXN-10784]]
 
−
* [[RXN-11060]]
 
−
* [[RXN-11627]]
 
−
* [[RXN-11889]]
 
−
* [[RXN-11890]]
 
−
* [[RXN-12002]]
 
−
* [[RXN-12123]]
 
−
* [[RXN-12125]]
 
−
* [[RXN-12126]]
 
−
* [[RXN-12127]]
 
−
* [[RXN-12128]]
 
−
* [[RXN-12196]]
 
−
* [[RXN-1225]]
 
−
* [[RXN-13607]]
 
−
* [[RXN-13608]]
 
−
* [[RXN-14361]]
 
−
* [[RXN-14561]]
 
−
* [[RXN-14841]]
 
−
* [[RXN-15117]]
 
−
* [[RXN-15205]]
 
−
* [[RXN-15276]]
 
−
* [[RXN-15277]]
 
−
* [[RXN-15278]]
 
−
* [[RXN-16027]]
 
−
* [[RXN-16975]]
 
−
* [[RXN-18266]]
 
−
* [[RXN-18302]]
 
−
* [[RXN-4726]]
 
−
* [[RXN-4733]]
 
−
* [[RXN-6501]]
 
−
* [[RXN-7667]]
 
−
* [[RXN-7828]]
 
−
* [[RXN-7873]]
 
−
* [[RXN-8228]]
 
−
* [[RXN-9000]]
 
−
* [[RXN-9104]]
 
−
* [[RXN1F-461]]
 
−
* [[RXN1F-462]]
 
−
* [[RXN66-162]]
 
−
* [[RXN66-168]]
 
−
* [[RXN66-83]]
 
−
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[TREHALOSE6PSYN-RXN]]
 
−
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
−
* [[UDPGth]]
 
−
* [[UG6PGT]]
 
−
* [[UG6PGTn]]
 
−
* [[UTCY]]
 
−
* [[UTUP]]
 
−
</div>
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=udp}}
 
−
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
 
−
{{#set: molecular-weight=401.14}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-6030

  • taxonomic-range:
    • tax-33090
    • tax-33208
  • common-name:
    • serotonin and melatonin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneACETYLSEROTONIN-O-METHYLTRANSFERASE-RXN ACETYLSEROTONIN-O-METHYLTRANSFERASE-RXN]
  • [NoneRXN3DJ-35528 RXN3DJ-35528]
  • [NoneTRYPTOPHAN-5-MONOOXYGENASE-RXN TRYPTOPHAN-5-MONOOXYGENASE-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY3O-246&oldid=39567"