Difference between revisions of "PWY3O-246"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] == * common-name: ** 3-chlorobenzaldehyde * smiles: ** c(=o)c1(c=cc=c(cl)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10660 CPD-10660] ==
 
* common-name:
 
* common-name:
** (2s)-liquiritigenin
+
** 3-chlorobenzaldehyde
 
* smiles:
 
* smiles:
** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
+
** c(=o)c1(c=cc=c(cl)c=1)
 
* inchi-key:
 
* inchi-key:
** furuxtvzlhccna-aweznqclsa-n
+
** srwilaksarhzpr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 256.257
+
** 140.569
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9910]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3221]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-liquiritigenin}}
+
{{#set: common-name=3-chlorobenzaldehyde}}
{{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}}
+
{{#set: inchi-key=inchikey=srwilaksarhzpr-uhfffaoysa-n}}
{{#set: molecular-weight=256.257}}
+
{{#set: molecular-weight=140.569}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-10660

  • common-name:
    • 3-chlorobenzaldehyde
  • smiles:
    • c(=o)c1(c=cc=c(cl)c=1)
  • inchi-key:
    • srwilaksarhzpr-uhfffaoysa-n
  • molecular-weight:
    • 140.569

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality