Difference between revisions of "PWY3O-355"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)...")
(Created page with "Category:pathway == Pathway PWY3O-355 == * taxonomic-range: ** tax-4751 * common-name: ** stearate biosynthesis iii (fungi) == Reaction(s) found == * RXN-9624 * RXN-...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] ==
+
== Pathway PWY3O-355 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** l-aspartate
+
** stearate biosynthesis iii (fungi)
* smiles:
+
== Reaction(s) found ==
** c(c(=o)[o-])c([n+])c(=o)[o-]
+
* [[RXN-9624]]
* inchi-key:
+
* [[RXN-9633]]
** ckljmwtzizzhcs-reohclbhsa-m
+
* [[RXN-9634]]
* molecular-weight:
+
* [[RXN3O-1803]]
** 132.096
+
* [[RXN3O-5293]]
== Reaction(s) known to consume the compound ==
+
* [[RXN3O-5304]]
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
== Reaction(s) not found ==
* [[ARGSUCCINSYN-RXN]]
+
* [NoneRXN-20769 RXN-20769]
* [[ASNSYNA-RXN]]
+
* [NoneRXN-20770 RXN-20770]
* [[ASNSYNB-RXN]]
+
{{#set: taxonomic-range=tax-4751}}
* [[ASPAMINOTRANS-RXN]]
+
{{#set: common-name=stearate biosynthesis iii (fungi)}}
* [[ASPARTATE--TRNA-LIGASE-RXN]]
+
{{#set: nb reaction found=6}}
* [[ASPARTATEKIN-RXN]]
+
{{#set: completion rate=1.0}}
* [[ASPCARBTRANS-RXN]]
+
{{#set: nb total reaction=6}}
* [[L-ASPARTATE-OXID-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
* [[RXN-10]]
 
* [[RXN-13697]]
 
* [[RXN-9772]]
 
* [[SAICARSYN-RXN]]
 
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
* [[3.4.11.21-RXN]]
 
* [[3.5.1.26-RXN]]
 
* [[ASPAMINOTRANS-RXN]]
 
* [[ASPARAGHYD-RXN]]
 
* [[ASPARTATEKIN-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 
* [[RXN-13697]]
 
* [[RXN0-6975]]
 
* [[RXN0-6987]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-aspartate}}
 
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
 
{{#set: molecular-weight=132.096}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY3O-355

  • taxonomic-range:
    • tax-4751
  • common-name:
    • stearate biosynthesis iii (fungi)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-20769 RXN-20769]
  • [NoneRXN-20770 RXN-20770]