Difference between revisions of "PWY3O-355"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] ==
+== Pathway PWY3O-355 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 9,15,9'-tri-cis-&zeta;-carotene
+** stearate biosynthesis iii (fungi)
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
+* [[RXN-9624]]
-* inchi-key:
+* [[RXN-9633]]
-** biwlelkafxrpde-lmarsqgmsa-n
+* [[RXN-9634]]
-* molecular-weight:
+* [[RXN3O-1803]]
-** 540.914
+* [[RXN3O-5293]]
-== Reaction(s) known to consume the compound ==
+* [[RXN3O-5304]]
-* [[RXN-11354]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-20769 RXN-20769]
-* [[RXN-11354]]
+* [NoneRXN-20770 RXN-20770]
-* [[RXN-11355]]
+{{#set: taxonomic-range=tax-4751}}
-* [[RXN-12244]]
+{{#set: common-name=stearate biosynthesis iii (fungi)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=6}}
-{{#set: common-name=9,15,9'-tri-cis-&zeta;-carotene}}
+{{#set: completion rate=1.0}}
-{{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=540.914}}