Difference between revisions of "PWY3O-355"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9,15,9'-tri-cis-ζ-carotene |
* smiles: | * smiles: | ||
| − | ** c(c(= | + | ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** biwlelkafxrpde-lmarsqgmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 540.914 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11354]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11354]] |
| − | + | * [[RXN-11355]] | |
| − | + | * [[RXN-12244]] | |
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9,15,9'-tri-cis-ζ-carotene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=540.914}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-7535
- common-name:
- 9,15,9'-tri-cis-ζ-carotene
- smiles:
- cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-lmarsqgmsa-n
- molecular-weight:
- 540.914
