Difference between revisions of "PWY3O-355"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] ==
+== Pathway PWY0-1568 ==
+* taxonomic-range:
+** tax-2
+** tax-2157
 * common-name:
-** 9,15,9'-tri-cis-&zeta;-carotene
+** nadh to cytochrome bd oxidase electron transfer ii
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
+* [[RXN0-5330]]
-* inchi-key:
+== Reaction(s) not found ==
-** biwlelkafxrpde-lmarsqgmsa-n
+* [NoneRXN0-5266 RXN0-5266]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2|tax-2157}}
-** 540.914
+{{#set: common-name=nadh to cytochrome bd oxidase electron transfer ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-11354]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-11354]]
-* [[RXN-11355]]
-* [[RXN-12244]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=9,15,9'-tri-cis-&zeta;-carotene}}
-{{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}
-{{#set: molecular-weight=540.914}}