Difference between revisions of "PWY3O-450"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-5-METHOXY-TRYPTAMINE N-ACETYL-5-METHOXY-TRYPTAMINE] == * common-name: ** melatonin * s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-hemoproteins Reduced-hemoproteins] == * common-name: ** a reduced hemoprotein == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-5-METHOXY-TRYPTAMINE N-ACETYL-5-METHOXY-TRYPTAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-hemoproteins Reduced-hemoproteins] ==
 
* common-name:
 
* common-name:
** melatonin
+
** a reduced hemoprotein
* smiles:
 
** cc(=o)nccc2(=cnc1(=c(c=c(oc)c=c1)2))
 
* inchi-key:
 
** drlfmbdrbrzale-uhfffaoysa-n
 
* molecular-weight:
 
** 232.282
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11056]]
 
* [[RXN-11057]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=melatonin}}
+
{{#set: common-name=a reduced hemoprotein}}
{{#set: inchi-key=inchikey=drlfmbdrbrzale-uhfffaoysa-n}}
 
{{#set: molecular-weight=232.282}}
 

Revision as of 14:19, 26 August 2019

Metabolite Reduced-hemoproteins

  • common-name:
    • a reduced hemoprotein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality