Difference between revisions of "PWY3O-6"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * common-name: ** dopaquinone * smiles: ** c([o-])(=o)c([n+])cc1(=c...")
(Created page with "Category:pathway == Pathway PWY-6857 == * taxonomic-range: ** tax-33208 * common-name: ** retinol biosynthesis == Reaction(s) found == * RXN-10841 * RXN-12575 * ...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] ==
+
== Pathway PWY-6857 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** dopaquinone
+
** retinol biosynthesis
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c([n+])cc1(=cc(=o)c(=o)c=c1)
+
* [[RXN-10841]]
* inchi-key:
+
* [[RXN-12575]]
** ahmiduvksgchau-lurjtmiesa-n
+
* [[RXN-12579]]
* molecular-weight:
+
== Reaction(s) not found ==
** 195.174
+
* [None2.3.1.135-RXN 2.3.1.135-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-13374 RXN-13374]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-12548 RXN-12548]
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
* [NoneRXN-12549 RXN-12549]
* [[RXN-13061]]
+
{{#set: taxonomic-range=tax-33208}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=retinol biosynthesis}}
{{#set: common-name=dopaquinone}}
+
{{#set: nb reaction found=3}}
{{#set: inchi-key=inchikey=ahmiduvksgchau-lurjtmiesa-n}}
+
{{#set: completion rate=0.43}}
{{#set: molecular-weight=195.174}}
+
{{#set: nb total reaction=7}}

Revision as of 20:17, 18 December 2020

Pathway PWY-6857

  • taxonomic-range:
    • tax-33208
  • common-name:
    • retinol biosynthesis

Reaction(s) found

Reaction(s) not found

  • [None2.3.1.135-RXN 2.3.1.135-RXN]
  • [NoneRXN-13374 RXN-13374]
  • [NoneRXN-12548 RXN-12548]
  • [NoneRXN-12549 RXN-12549]