Difference between revisions of "PWY490-4"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-2 CPD1F-2] ==
+== Pathway PWY490-4 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** (-)-methyl jasmonate
+** l-asparagine biosynthesis iii (trna-dependent)
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc1(c(=o)ccc1cc(oc)=o)
+* [[6.3.5.6-RXN]]
-* inchi-key:
+* [[RXN-12460]]
-** gewdntwnsazudx-wqmvxfaesa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN490-3616 RXN490-3616]
-** 224.299
+* [NoneGLUTAMIN-RXN GLUTAMIN-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-20081 RXN-20081]
-* [[RXN-10767]]
+* [NoneRXN-20080 RXN-20080]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=l-asparagine biosynthesis iii (trna-dependent)}}
-{{#set: common-name=(-)-methyl jasmonate}}
+{{#set: nb reaction found=2}}
-{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
+{{#set: completion rate=0.5}}
-{{#set: molecular-weight=224.299}}
+{{#set: nb total reaction=4}}