Difference between revisions of "PWY490-4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DELTA1-PYRROLINE_5-CARBOXYLATE L-DELTA1-PYRROLINE_5-CARBOXYLATE] == * common-name: ** (s)-1-p...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-2 CPD1F-2] == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-2 CPD1F-2] == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (-)-methyl jasmonate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc1(c(=o)ccc1cc(oc)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gewdntwnsazudx-wqmvxfaesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10767]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(-)-methyl jasmonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.299}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD1F-2
- common-name:
- (-)-methyl jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc(oc)=o)
- inchi-key:
- gewdntwnsazudx-wqmvxfaesa-n
- molecular-weight:
- 224.299
