Difference between revisions of "PWY4FS-2"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] ==
+== Pathway PWY4FS-2 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** nebramycin 5'
+** phosphatidylcholine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+* [[2.7.7.15-RXN]]
-* inchi-key:
+* [[RXN-5781]]
-** yppfejhohnpklt-pbsuhmdjsa-s
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-5642 RXN-5642]
-** 515.583
+* [NoneRXN-5643 RXN-5643]
-== Reaction(s) known to consume the compound ==
+* [None2.1.1.103-RXN 2.1.1.103-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[RXN-13168]]
+{{#set: common-name=phosphatidylcholine biosynthesis ii}}
-* [[RXN-15284]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.4}}
-{{#set: common-name=nebramycin 5'}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
-{{#set: molecular-weight=515.583}}