Difference between revisions of "PWY4FS-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-N7-methylguanine-2069 23S-rRNA-N7-methylguanine-2069] == * common-name: ** an n7-methy...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-N7-methylguanine-2069 23S-rRNA-N7-methylguanine-2069] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14158 CPD-14158] ==
 
* common-name:
 
* common-name:
** an n7-methylguanine2069 in 23s rrna
+
** nebramycin 5'
 +
* smiles:
 +
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
 +
* inchi-key:
 +
** yppfejhohnpklt-pbsuhmdjsa-s
 +
* molecular-weight:
 +
** 515.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6950]]
+
* [[RXN-13168]]
 +
* [[RXN-15284]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n7-methylguanine2069 in 23s rrna}}
+
{{#set: common-name=nebramycin 5'}}
 +
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
 +
{{#set: molecular-weight=515.583}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-14158

  • common-name:
    • nebramycin 5'
  • smiles:
    • c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
  • inchi-key:
    • yppfejhohnpklt-pbsuhmdjsa-s
  • molecular-weight:
    • 515.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality