Difference between revisions of "PWY4FS-3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-beta-D-Glucosides Aryl-beta-D-Glucosides] == * common-name: ** an aryl β-d-glucoside...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylphenyl sulfate |
| + | * smiles: | ||
| + | ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) | ||
| + | * inchi-key: | ||
| + | ** wgnakzgusrvwrh-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 187.19 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15588]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15588]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylphenyl sulfate}} |
| + | {{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=187.19}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-16819
- common-name:
- 4-methylphenyl sulfate
- smiles:
- cc1(c=cc(=cc=1)os(=o)(=o)[o-])
- inchi-key:
- wgnakzgusrvwrh-uhfffaoysa-m
- molecular-weight:
- 187.19
