Difference between revisions of "PWY4FS-3"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
+== Pathway PWY4FS-3 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 4-methylphenyl sulfate
+** phosphatidylcholine biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
+* [[2.1.1.71-RXN]]
-* inchi-key:
+* [[RXN4FS-2]]
-** wgnakzgusrvwrh-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [None2.1.1.103-RXN 2.1.1.103-RXN]
-** 187.19
+* [NoneRXN4FS-1 RXN4FS-1]
-== Reaction(s) known to consume the compound ==
+* [None2.7.7.57-RXN 2.7.7.57-RXN]
-* [[RXN-15588]]
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=phosphatidylcholine biosynthesis iii}}
-* [[RXN-15588]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.4}}
-{{#set: common-name=4-methylphenyl sulfate}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
-{{#set: molecular-weight=187.19}}