Difference between revisions of "PWY4FS-6"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+== Pathway PWY4FS-6 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** unsaturated gellan tetrasaccharide
+** phosphatidylethanolamine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
+* [[2.7.7.14-RXN]]
-* inchi-key:
+* [[ETHANOLAMINE-KINASE-RXN]]
-** jmdplhpaglyhci-pqvubfrasa-m
+* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 645.544
+* [NoneRXN-5641 RXN-5641]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2759}}
-* [[RXN-12270]]
+{{#set: common-name=phosphatidylethanolamine biosynthesis ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.75}}
-{{#set: common-name=unsaturated gellan tetrasaccharide}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
-{{#set: molecular-weight=645.544}}