Difference between revisions of "PWY4FS-6"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2350 CPD0-2350] == * common-name: ** a polycistronic trna precursor == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] == |
* common-name: | * common-name: | ||
| − | ** | + | ** unsaturated gellan tetrasaccharide |
| + | * smiles: | ||
| + | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4))) | ||
| + | * inchi-key: | ||
| + | ** jmdplhpaglyhci-pqvubfrasa-m | ||
| + | * molecular-weight: | ||
| + | ** 645.544 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12270]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=unsaturated gellan tetrasaccharide}} |
| + | {{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}} | ||
| + | {{#set: molecular-weight=645.544}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-13187
- common-name:
- unsaturated gellan tetrasaccharide
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
- inchi-key:
- jmdplhpaglyhci-pqvubfrasa-m
- molecular-weight:
- 645.544
