Difference between revisions of "PWY4FS-8"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc...")
(Created page with "Category:pathway == Pathway PWY4FS-8 == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** phosphatidylglycerol biosynthesis ii (non-plastidic) == Reaction(s) found...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] ==
+
== Pathway PWY4FS-8 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** ump
+
** phosphatidylglycerol biosynthesis ii (non-plastidic)
* smiles:
+
== Reaction(s) found ==
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
* [[PGPPHOSPHA-RXN]]
* inchi-key:
+
* [[PHOSPHAGLYPSYN-RXN]]
** djjcxfvjdgthfx-xvfcmesisa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 322.168
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=phosphatidylglycerol biosynthesis ii (non-plastidic)}}
* [[RXN-12002]]
+
{{#set: nb reaction found=2}}
* [[RXN-14025]]
+
{{#set: completion rate=1.0}}
* [[RXN-8975]]
+
{{#set: nb total reaction=2}}
* [[UDPGALth]]
 
* [[UMPP]]
 
== Reaction(s) known to produce the compound ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.7.8.15-RXN]]
 
* [[2.7.8.17-RXN]]
 
* [[AUPT]]
 
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[OROTPDECARB-RXN]]
 
* [[ORPDC]]
 
* [[PHOSNACMURPENTATRANS-RXN]]
 
* [[RXN-11347]]
 
* [[RXN-12197]]
 
* [[RXN-12199]]
 
* [[RXN-14139]]
 
* [[RXN-8975]]
 
* [[UDPGALth]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[UTPPH]]
 
* [[UTUP]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=ump}}
 
{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}
 
{{#set: molecular-weight=322.168}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY4FS-8

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • phosphatidylglycerol biosynthesis ii (non-plastidic)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present