Difference between revisions of "PWY4FS-8"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11700 CPD-11700] == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosp...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == |
* common-name: | * common-name: | ||
− | ** | + | ** ump |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** djjcxfvjdgthfx-xvfcmesisa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 322.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12002]] |
− | * [[RXN- | + | * [[RXN-14025]] |
− | * [[RXN- | + | * [[RXN-8975]] |
+ | * [[UDPGALth]] | ||
+ | * [[UMPP]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> |
− | * [[RXN- | + | * [[2.7.8.15-RXN]] |
− | * [[RXN- | + | * [[2.7.8.17-RXN]] |
+ | * [[AUPT]] | ||
+ | * [[DATUP]] | ||
+ | * [[DCTUP]] | ||
+ | * [[DGTUP]] | ||
+ | * [[DTTUP]] | ||
+ | * [[DUTUP]] | ||
+ | * [[GTUP]] | ||
+ | * [[ITUP]] | ||
+ | * [[OROTPDECARB-RXN]] | ||
+ | * [[ORPDC]] | ||
+ | * [[PHOSNACMURPENTATRANS-RXN]] | ||
+ | * [[RXN-11347]] | ||
+ | * [[RXN-12197]] | ||
+ | * [[RXN-12199]] | ||
+ | * [[RXN-14139]] | ||
+ | * [[RXN-8975]] | ||
+ | * [[UDPGALth]] | ||
+ | * [[URACIL-PRIBOSYLTRANS-RXN]] | ||
+ | * [[URIDINEKIN-RXN]] | ||
+ | * [[URKI-RXN]] | ||
+ | * [[UTPPH]] | ||
+ | * [[UTUP]] | ||
+ | </div> | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ump}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=322.168}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite UMP
- common-name:
- ump
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
- inchi-key:
- djjcxfvjdgthfx-xvfcmesisa-l
- molecular-weight:
- 322.168