Difference between revisions of "PWY66-161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: **...")
(Created page with "Category:pathway == Pathway PWY-7205 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** cmp phosphorylation == Reaction(s) found == * CDPKIN-RXN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Pathway PWY-7205 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+
** cmp phosphorylation
* smiles:
+
== Reaction(s) found ==
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[CDPKIN-RXN]]
* inchi-key:
+
* [[RXN-11832]]
** jlhullpftgligf-dbyuabgnsa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 1051.975
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=cmp phosphorylation}}
* [[RXN-16097]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[RXN-16096]]
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
 
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
 
{{#set: molecular-weight=1051.975}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-7205

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • cmp phosphorylation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present