Difference between revisions of "PWY66-21"
Jump to navigation
Jump to search
(Semantic MediaWiki default vocabulary import) |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | * | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == |
| − | + | * common-name: | |
| − | [[ | + | ** 3-keto-β-d-galactose |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(c(c1o)=o)o)o) | ||
| + | * inchi-key: | ||
| + | ** apiqnbnbiiccon-fkmsrsahsa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.141 | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[KETOLACTOSE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-keto-β-d-galactose}} | ||
| + | {{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}} | ||
| + | {{#set: molecular-weight=178.141}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-1242
- common-name:
- 3-keto-β-d-galactose
- smiles:
- c(o)c1(oc(c(c(c1o)=o)o)o)
- inchi-key:
- apiqnbnbiiccon-fkmsrsahsa-n
- molecular-weight:
- 178.141
