Difference between revisions of "PWY66-21"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1...")
(Created page with "Category:pathway == Pathway PWY66-21 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** ethanol degradation ii == Reaction(s) found == * ACETATE--C...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] ==
+
== Pathway PWY66-21 ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** ethanol degradation ii
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(c(c(c1o)=o)o)o)
+
* [[ACETATE--COA-LIGASE-RXN]]
* inchi-key:
+
* [[ALCOHOL-DEHYDROG-RXN]]
** apiqnbnbiiccon-fkmsrsahsa-n
+
* [[RXN66-3]]
* molecular-weight:
+
== Reaction(s) not found ==
** 178.141
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=ethanol degradation ii}}
* [[KETOLACTOSE-RXN]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: nb total reaction=3}}
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY66-21

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • ethanol degradation ii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present