Difference between revisions of "PWY66-21"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-beta-D-Glucosides Aryl-beta-D-Glucosides] == * common-name: ** an aryl β-d-glucoside...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-beta-D-Glucosides Aryl-beta-D-Glucosides] ==
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** an aryl β-d-glucoside
* smiles:
 
** c(o)c1(oc(c(c(c1o)=o)o)o)
 
* inchi-key:
 
** apiqnbnbiiccon-fkmsrsahsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOLACTOSE-RXN]]
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: common-name=an aryl β-d-glucoside}}
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Revision as of 09:22, 27 August 2019

Metabolite Aryl-beta-D-Glucosides

  • common-name:
    • an aryl β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality