Difference between revisions of "PWY66-221"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] ==
+== Pathway PWY-6827 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** dopamine
+** gellan degradation
-* smiles:
+== Reaction(s) found ==
-** c(cc1(c=c(c(=cc=1)o)o))[n+]
+* [[RXN-12270]]
-* inchi-key:
+== Reaction(s) not found ==
-** vyfyytllbukuhu-uhfffaoysa-o
+* [NoneRXN-12269 RXN-12269]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 154.188
+{{#set: common-name=gellan degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+{{#set: completion rate=0.5}}
-* [[RXN6666-4]]
+{{#set: nb total reaction=2}}
-* [[RXN6666-9]]
-== Reaction(s) known to produce the compound ==
-* [[RXN66-221]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=dopamine}}
-{{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}}
-{{#set: molecular-weight=154.188}}