Difference between revisions of "PWY66-241"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] ==
+== Pathway PWY66-241 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** dudp
+** bupropion degradation
-* smiles:
+== Reaction(s) found ==
-** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
+* [[RXN66-181]]
-* inchi-key:
+== Reaction(s) not found ==
-** qhwztvccbmiike-shyzeuofsa-k
+* [NoneRXN66-184 RXN66-184]
-* molecular-weight:
+* [NoneRXN66-182 RXN66-182]
-** 385.14
+* [NoneRXN66-185 RXN66-185]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN66-183 RXN66-183]
-* [[ATDUD]]
+{{#set: taxonomic-range=tax-40674}}
-* [[ATDUDm]]
+{{#set: common-name=bupropion degradation}}
-* [[DUDPKIN-RXN]]
+{{#set: nb reaction found=1}}
-* [[RXN-14220]]
+{{#set: completion rate=0.2}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=5}}
-* [[DUDT]]
-* [[DUTCP]]
-* [[DUTUP]]
-* [[RXN-14219]]
-* [[RXN0-722]]
-* [[UDPREDUCT-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=dudp}}
-{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
-{{#set: molecular-weight=385.14}}