Difference between revisions of "PWY66-241"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] == * common-name: ** an insertion sequence e...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IS30-Insertion-Sequences IS30-Insertion-Sequences] ==
 
* common-name:
 
* common-name:
** dudp
+
** an insertion sequence element is30
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** qhwztvccbmiike-shyzeuofsa-k
 
* molecular-weight:
 
** 385.14
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDUD]]
+
* [[RXN0-5131]]
* [[ATDUDm]]
 
* [[DUDPKIN-RXN]]
 
* [[RXN-14220]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DUDT]]
+
* [[RXN0-5131]]
* [[DUTCP]]
 
* [[DUTUP]]
 
* [[RXN-14219]]
 
* [[RXN0-722]]
 
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dudp}}
+
{{#set: common-name=an insertion sequence element is30}}
{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
 
{{#set: molecular-weight=385.14}}
 

Revision as of 14:18, 26 August 2019

Metabolite IS30-Insertion-Sequences

  • common-name:
    • an insertion sequence element is30

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality