Difference between revisions of "PWY66-301"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z13E-15S-15-HYDROPEROXYICOS 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS] ==
+== Pathway PWY-6703 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (15s)-hpete
+** preq0 biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
+* [[GTP-CYCLOHYDRO-I-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bfwytordsfivkp-vaeksgalsa-m
+* [NoneRXN-12093 RXN-12093]
-* molecular-weight:
+* [NoneRXN0-5507 RXN0-5507]
-** 335.462
+* [NoneRXN0-6575 RXN0-6575]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=preq0 biosynthesis}}
-* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=(15s)-hpete}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}}
-{{#set: molecular-weight=335.462}}