Difference between revisions of "PWY66-387"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] == * common-name: ** 2-deoxy-d-glu...")
 
(Created page with "Category:pathway == Pathway PWY66-387 == * taxonomic-range: ** tax-33208 * common-name: ** fatty acid α-oxidation ii == Reaction(s) found == * RXN66-469 * RXN6...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXY-D-GLUCOSE-6-PHOSPHATE 2-DEOXY-D-GLUCOSE-6-PHOSPHATE] ==
+
== Pathway PWY66-387 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** 2-deoxy-d-glucose 6-phosphate
+
** fatty acid α-oxidation ii
* smiles:
+
== Reaction(s) found ==
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
+
* [[RXN66-469]]
* inchi-key:
+
* [[RXN66-470]]
** uqjfzaagzayvkz-cermhhmhsa-l
+
* [[RXN66-472]]
* molecular-weight:
+
* [[RXN66-483]]
** 242.122
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN66-471 RXN66-471]
* [[3.1.3.68-RXN]]
+
* [NoneFORMYL-COA-HYDROLASE-RXN FORMYL-COA-HYDROLASE-RXN]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-33208}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=fatty acid α-oxidation ii}}
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
+
{{#set: nb reaction found=4}}
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
+
{{#set: completion rate=0.67}}
{{#set: molecular-weight=242.122}}
+
{{#set: nb total reaction=6}}

Latest revision as of 10:57, 18 March 2021

Pathway PWY66-387

  • taxonomic-range:
    • tax-33208
  • common-name:
    • fatty acid α-oxidation ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-471 RXN66-471]
  • [NoneFORMYL-COA-HYDROLASE-RXN FORMYL-COA-HYDROLASE-RXN]