Difference between revisions of "PWY66-388"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * common-name: ** 3-oxo-(5z)-tetradecenoyl-coa * smiles: ** ccccccccc=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO PRO] == * common-name: ** l-proline * smiles: ** c1([n+]c(cc1)c(=o)[o-]) * inchi-key: ** on...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRO PRO] ==
 
* common-name:
 
* common-name:
** 3-oxo-(5z)-tetradecenoyl-coa
+
** l-proline
 
* smiles:
 
* smiles:
** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1([n+]c(cc1)c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** kadpwmjvuvwqnk-stfckwfxsa-j
+
** onibwkktopovia-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 985.829
+
** 115.132
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14393]]
+
* [[PROLINE--TRNA-LIGASE-RXN]]
* [[RXN-14394]]
+
* [[RXN-14903]]
 +
* [[RXN0-7008]]
 +
* [[RXN490-3641]]
 +
* [[RXN66-542]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14393]]
+
* [[3.4.11.5-RXN]]
 +
* [[3.4.13.9-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[PYRROLINECARBREDUCT-RXN]]
 +
* [[RXN0-6988]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=l-proline}}
{{#set: inchi-key=inchikey=kadpwmjvuvwqnk-stfckwfxsa-j}}
+
{{#set: inchi-key=inchikey=onibwkktopovia-bypyzucnsa-n}}
{{#set: molecular-weight=985.829}}
+
{{#set: molecular-weight=115.132}}

Revision as of 14:18, 26 August 2019

Metabolite PRO

  • common-name:
    • l-proline
  • smiles:
    • c1([n+]c(cc1)c(=o)[o-])
  • inchi-key:
    • onibwkktopovia-bypyzucnsa-n
  • molecular-weight:
    • 115.132

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality