Difference between revisions of "PWY66-388"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] ==
+== Pathway PWY66-388 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** 3-oxo-(5z)-tetradecenoyl-coa
+** fatty acid &alpha;-oxidation iii
-* smiles:
+== Reaction(s) found ==
-** ccccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN66-476]]
-* inchi-key:
+* [[RXN66-477]]
-** kadpwmjvuvwqnk-stfckwfxsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneFORMYL-COA-HYDROLASE-RXN FORMYL-COA-HYDROLASE-RXN]
-** 985.829
+* [NoneRXN3O-4042 RXN3O-4042]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN66-475 RXN66-475]
-* [[RXN-14393]]
+* [NoneRXN66-474 RXN66-474]
-* [[RXN-14394]]
+* [NoneRXN-20504 RXN-20504]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33208}}
-* [[RXN-14393]]
+{{#set: common-name=fatty acid &alpha;-oxidation iii}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=3-oxo-(5z)-tetradecenoyl-coa}}
+{{#set: completion rate=0.29}}
-{{#set: inchi-key=inchikey=kadpwmjvuvwqnk-stfckwfxsa-j}}
+{{#set: nb total reaction=7}}
-{{#set: molecular-weight=985.829}}