Difference between revisions of "PWY66-389"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=...")
(Created page with "Category:pathway == Pathway PWY66-389 == * taxonomic-range: ** tax-40674 * common-name: ** phytol degradation == Reaction(s) found == * RXN66-478 * RXN66-479 * R...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Pathway PWY66-389 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** n-acetyl-serotonin sulfate
+
** phytol degradation
* smiles:
+
== Reaction(s) found ==
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
+
* [[RXN66-478]]
* inchi-key:
+
* [[RXN66-479]]
** ucajznvfrvluls-uhfffaoysa-m
+
* [[RXN66-480]]
* molecular-weight:
+
* [[RXN66-482]]
** 297.305
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
All reactions of this pathways are in present
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-40674}}
* [[RXN-11059]]
+
{{#set: common-name=phytol degradation}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=4}}
{{#set: common-name=n-acetyl-serotonin sulfate}}
+
{{#set: completion rate=1.0}}
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
+
{{#set: nb total reaction=4}}
{{#set: molecular-weight=297.305}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY66-389

  • taxonomic-range:
    • tax-40674
  • common-name:
    • phytol degradation

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present