Difference between revisions of "PWY66-395"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+== Pathway PWY-7455 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
+** allopregnanolone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+* [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** yyuzysvpfvoylb-rguwmiccsa-j
+* [NoneRXN66-567 RXN66-567]
-* molecular-weight:
+{{#set: taxonomic-range=tax-40674}}
-** 983.813
+{{#set: common-name=allopregnanolone biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-10707]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-10700]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
-{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}
-{{#set: molecular-weight=983.813}}