Difference between revisions of "PWY66-399"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAGATOSE-1-6-DIPHOSPHATE TAGATOSE-1-6-DIPHOSPHATE] ==
+== Pathway PWY66-399 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** d-tagatofuranose 1,6-bisphosphate
+** gluconeogenesis iii
-* smiles:
+== Reaction(s) found ==
-** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
+* [[2PGADEHYDRAT-RXN]]
-* inchi-key:
+* [[F16ALDOLASE-RXN]]
-** rnbgygvwrkecfj-oexcpvawsa-j
+* [[F16BDEPHOS-RXN]]
-* molecular-weight:
+* [[GAPOXNPHOSPHN-RXN]]
-** 336.085
+* [[MALATE-DEH-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[PGLUCISOM-RXN]]
-* [[TAGAALDOL-RXN]]
+* [[PHOSGLYPHOS-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[PYRUVATE-CARBOXYLASE-RXN]]
-* [[TAGAKIN-RXN]]
+* [[RXN-15513]]
-== Reaction(s) of unknown directionality ==
+* [[RXN66-526]]
-{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+* [[TRIOSEPISOMERIZATION-RXN]]
-{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
+== Reaction(s) not found ==
-{{#set: molecular-weight=336.085}}
+* [None4.1.1.32-RXN 4.1.1.32-RXN]
+{{#set: taxonomic-range=tax-33208}}
+{{#set: common-name=gluconeogenesis iii}}
+{{#set: nb reaction found=11}}
+{{#set: completion rate=0.92}}
+{{#set: nb total reaction=12}}