Difference between revisions of "PWY66-4"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dioleoyl phosphatidate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mhuwzntuiifhas-dssvuwshsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 698.959 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15068]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15043]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dioleoyl phosphatidate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=698.959}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-8268
- common-name:
- dioleoyl phosphatidate
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
- inchi-key:
- mhuwzntuiifhas-dssvuwshsa-l
- molecular-weight:
- 698.959
