Difference between revisions of "PWY66-422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=...")
(Created page with "Category:pathway == Pathway PWY66-422 == * taxonomic-range: ** tax-2759 * common-name: ** d-galactose degradation v (leloir pathway) == Reaction(s) found == * ALDOSE1EPI...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] ==
+
== Pathway PWY66-422 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** anserine
+
** d-galactose degradation v (leloir pathway)
* smiles:
+
== Reaction(s) found ==
** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
+
* [[ALDOSE1EPIM-RXN]]
* inchi-key:
+
* [[GALACTOKIN-RXN]]
** myyiahxivfadcu-qmmmgpobsa-n
+
* [[GALACTURIDYLYLTRANS-RXN]]
* molecular-weight:
+
* [[PHOSPHOGLUCMUT-RXN]]
** 240.261
+
* [[UDPGLUCEPIM-RXN]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
* [[X-METHYL-HIS-DIPEPTIDASE-RXN]]
+
No padmetRef was given during wikipage creation or pathway not in metacyc, data not available
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2759}}
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+
{{#set: common-name=d-galactose degradation v (leloir pathway)}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=5}}
{{#set: common-name=anserine}}
+
{{#set: completion rate=n.a}}
{{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}}
+
{{#set: nb total reaction=n.a}}
{{#set: molecular-weight=240.261}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY66-422

  • taxonomic-range:
    • tax-2759
  • common-name:
    • d-galactose degradation v (leloir pathway)

Reaction(s) found

Reaction(s) not found

No padmetRef was given during wikipage creation or pathway not in metacyc, data not available