Difference between revisions of "PWY66-422"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Asparagine Protein-L-Asparagine] == * common-name: ** a [protein]-l-asparagine == Rea...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-401 CPD-401] == |
* common-name: | * common-name: | ||
| − | ** | + | ** anserine |
| + | * smiles: | ||
| + | ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** myyiahxivfadcu-qmmmgpobsa-n | ||
| + | * molecular-weight: | ||
| + | ** 240.261 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[X-METHYL-HIS-DIPEPTIDASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CARNOSINE-N-METHYLTRANSFERASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=anserine}} |
| + | {{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}} | ||
| + | {{#set: molecular-weight=240.261}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-401
- common-name:
- anserine
- smiles:
- cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
- inchi-key:
- myyiahxivfadcu-qmmmgpobsa-n
- molecular-weight:
- 240.261
