Difference between revisions of "PWY6666-1"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * common-name: ** 4α-methyl-5α-cholesta-8-en-3-one * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
 
* common-name:
 
* common-name:
** 3-[(3'-methylthio)propyl]malate
+
** 4α-methyl-5α-cholesta-8-en-3-one
 
* smiles:
 
* smiles:
** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
+
** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(=o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** sqxviiopmysncp-uhfffaoysa-l
+
** sdzuxffgoqzlpk-sinuoacosa-n
 
* molecular-weight:
 
* molecular-weight:
** 220.24
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18208]]
+
* [[RXN66-19]]
* [[RXNQT-4165]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18208]]
+
* [[RXN66-18]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(3'-methylthio)propyl]malate}}
+
{{#set: common-name=4α-methyl-5α-cholesta-8-en-3-one}}
{{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=sdzuxffgoqzlpk-sinuoacosa-n}}
{{#set: molecular-weight=220.24}}
+
{{#set: molecular-weight=398.671}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-8614

  • common-name:
    • 4α-methyl-5α-cholesta-8-en-3-one
  • smiles:
    • cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)c(c)c(=o)cc3)))cc4)))c
  • inchi-key:
    • sdzuxffgoqzlpk-sinuoacosa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality