Difference between revisions of "PWY6666-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smi...")
(Created page with "Category:pathway == Pathway PWY6666-2 == * taxonomic-range: ** tax-33208 * common-name: ** dopamine degradation == Reaction(s) found == * RXN6666-4 * RXN6666-5 * [...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] ==
+
== Pathway PWY6666-2 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
+
** dopamine degradation
* smiles:
+
== Reaction(s) found ==
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
* [[RXN6666-4]]
* inchi-key:
+
* [[RXN6666-5]]
** lpdgucimnbnwej-bxzvqshesa-n
+
* [[RXN6666-9]]
* molecular-weight:
+
== Reaction(s) not found ==
** 782.092
+
* [NoneRXN6666-6 RXN6666-6]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN6666-7 RXN6666-7]
* [[RXN-8330]]
+
{{#set: taxonomic-range=tax-33208}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=dopamine degradation}}
* [[RXN-8321]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.6}}
{{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: nb total reaction=5}}
{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
 
{{#set: molecular-weight=782.092}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY6666-2

  • taxonomic-range:
    • tax-33208
  • common-name:
    • dopamine degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN6666-6 RXN6666-6]
  • [NoneRXN6666-7 RXN6666-7]