Difference between revisions of "PWY6666-2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] == * common-name: ** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine * smi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-Dehydrogenase-Phosphoserine Pyruvate-Dehydrogenase-Phosphoserine] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-Dehydrogenase-Phosphoserine Pyruvate-Dehydrogenase-Phosphoserine] ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-oleoyl-phosphatidylcholine
+
** a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** lpdgucimnbnwej-bxzvqshesa-n
 
* molecular-weight:
 
** 782.092
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8330]]
+
* [[3.1.3.43-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8321]]
+
* [[2.7.11.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate}}
{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
 
{{#set: molecular-weight=782.092}}
 

Revision as of 09:22, 27 August 2019

Metabolite Pyruvate-Dehydrogenase-Phosphoserine

  • common-name:
    • a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e1 α subunit]-l-serine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.